N-benzylacetoacetamide
product Name N-benzylacetoacetamide
Synonyms Acetoaceticbenzylamide; AAPCT; Pigment assistant YH160; N-benzyl-3-oxobutanamide
Molecular Formula C11H13NO2
Molecular Weight 191.2264
InChI InChI=1/C11H13NO2/c1-9(13)7-11(14)12-8-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,12,14)
CAS Registry Number 882-36-0
EINECS 212-928-5
Molecular Structure
Density 1.093g/cm3
Boiling point 399.4°C at 760 mmHg
Refractive index 1.522
Flash point 174.4°C
Vapour Pressur 1.38E-06mmHg at 25°C |
|
|
|
| Specifications︰ | N-benzylacetoacetamide (AABA) purity: 99% MIN |
| Advantages︰ | Our company possesses advanced manufacturing and testing equipment, strong production capacity and strong technical force. |
|
|
|